| Name: | PABELLONDEPICAITE | ||
| Specification: | [1], DN | ||
| Formula: | Cu2+2[N3C2H2]2[NH3]2[NO3]Cl · 2H2O | ||
| Symmetry Class: | orthorhombic | ||
| Space Group: | P mma | ||
| Unit Cell Parameters: | a = 7.2118 | b = 9.0983 | c = 11.1280 | ||
| Number of Formula Unit: | Z = 2 | Unit Cell Volume, Å3: | Vc = 730.17 |
| Number of Atomic Position per full Unit Cell: | P/U = 82 | Molar Volume, cm3/mol: | Vm = 219.90 |
| Number of Reflexes used in Structure Determination: | NR = 482 | X-ray density, g/cm3: | p = 1.96 |
| R-factor: | R = 0.0665 | MU, 1/cm: | µ = 57.183 |
| Wave Length for Calculated Powder Diffraction Patterns: | Cu=1.54056 | Mass attenuation coefficient, cm2/g: | µ/p = 29.195 |
| Theta-Interval for CPDP: | T/I = 1-45 | ||