| Name: | PARAERSHOVITE | ||
| Specification: | [1], DN | ||
| Formula: | Na3K3Fe3+2[Si4O10OH]2(OH)2 · 4H2O | ||
| Symmetry Class: | triclinic | ||
| Space Group: | P 1(-) | ||
| Unit Cell Parameters: | a = 10.1978 | b = 12.0155 | c = 5.2263 | alpha = 103.4000 | beta = 96.0000 | gamma = 91.7000 | ||
| Number of Formula Unit: | Z = 1 | Unit Cell Volume, Å3: | Vc = 618.46 |
| Number of Atomic Position per full Unit Cell: | P/U = 63 | Molar Volume, cm3/mol: | Vm = 372.52 |
| Number of Reflexes used in Structure Determination: | - | X-ray density, g/cm3: | p = 2.58 |
| R-factor: | - | MU, 1/cm: | µ = 174.958 |
| Wave Length for Calculated Powder Diffraction Patterns: | Co=1.78892 | Mass attenuation coefficient, cm2/g: | µ/p = 67.716 |
| Theta-Interval for CPDP: | T/I = 1-45 | ||