| Name: | MUNAKATAITE | ||
| Specification: | [1] | ||
| Formula: | Pb2Cu2[Se++++O3][SO4](OH)4 | ||
| Symmetry Class: | monoclinic-beta | ||
| Space Group: | P 2(1)/m | ||
| Unit Cell Parameters: | a = 9.8020 | b = 5.6750 | c = 9.2810 | beta = 102.4000 | ||
| Number of Formula Unit: | Z = 2 | Unit Cell Volume, Å3: | Vc = 504.14 |
| Number of Atomic Position per full Unit Cell: | P/U = 42 | Molar Volume, cm3/mol: | Vm = 151.83 |
| Number of Reflexes used in Structure Determination: | - | X-ray density, g/cm3: | p = 5.33 |
| R-factor: | - | MU, 1/cm: | µ = 729.842 |
| Wave Length for Calculated Powder Diffraction Patterns: | Cu=1.54056 | Mass attenuation coefficient, cm2/g: | µ/p = 136.972 |
| Theta-Interval for CPDP: | T/I = 1-45 | ||